C30H20FN3O3 — CID 26892611
(1S,11R,12S,16R)-11-(4-fluorobenzoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 26892611) has the molecular formula C30H20FN3O3 and a molecular weight of 489.51 g/mol. Its IUPAC name is (1S,11R,12S,16R)-11-(4-fluorobenzoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11R,12S,16R)-11-(4-fluorobenzoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 26892611 |
| Molecular Formula | C30H20FN3O3 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (1S,11R,12S,16R)-11-(4-fluorobenzoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(F)cc1)[C@H]1[C@H]2C(=O)N(c3ccc4ccccc4c3)C(=O)[C@H]2[C@H]2c3ccccc3C=NN21 |
| InChI | InChI=1S/C30H20FN3O3/c31-21-12-9-18(10-13-21)28(35)27-25-24(26-23-8-4-3-7-20(23)16-32-34(26)27)29(36)33(30(25)37)22-14-11-17-5-1-2-6-19(17)15-22/h1-16,24-27H/t24-,25+,26-,27-/m1/s1 |
| InChIKey | YKZGNVBAOUDJSS-HVWQDESWSA-N |
| XLogP | 4.74 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|