C28H25N3O3 — CID 3493228
11-(2,2-dimethylpropanoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3493228) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 11-(2,2-dimethylpropanoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 11-(2,2-dimethylpropanoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3493228 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 11-(2,2-dimethylpropanoyl)-14-naphthalen-2-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | CC(C)(C)C(=O)C1C2C(=O)N(c3ccc4ccccc4c3)C(=O)C2C2c3ccccc3C=NN12 |
| InChI | InChI=1S/C28H25N3O3/c1-28(2,3)25(32)24-22-21(23-20-11-7-6-10-18(20)15-29-31(23)24)26(33)30(27(22)34)19-13-12-16-8-4-5-9-17(16)14-19/h4-15,21-24H,1-3H3 |
| InChIKey | SUHAARTWNXITOY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|