C26H17ClFN3O3 — CID 3746148
11-(4-chlorobenzoyl)-14-(3-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3746148) has the molecular formula C26H17ClFN3O3 and a molecular weight of 473.89 g/mol. Its IUPAC name is 11-(4-chlorobenzoyl)-14-(3-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 11-(4-chlorobenzoyl)-14-(3-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3746148 |
| Molecular Formula | C26H17ClFN3O3 |
| Molecular Weight | 473.89 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 11-(4-chlorobenzoyl)-14-(3-fluorophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(Cl)cc1)C1C2C(=O)N(c3cccc(F)c3)C(=O)C2C2c3ccccc3C=NN12 |
| InChI | InChI=1S/C26H17ClFN3O3/c27-16-10-8-14(9-11-16)24(32)23-21-20(22-19-7-2-1-4-15(19)13-29-31(22)23)25(33)30(26(21)34)18-6-3-5-17(28)12-18/h1-13,20-23H |
| InChIKey | KKXLQJYRPTZCGW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|