C26H16Cl2FN3O3 — CID 27858747
(1S,11R,12S,16R)-14-(2,4-dichlorophenyl)-11-(4-fluorobenzoyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 27858747) has the molecular formula C26H16Cl2FN3O3 and a molecular weight of 508.34 g/mol. Its IUPAC name is (1S,11R,12S,16R)-14-(2,4-dichlorophenyl)-11-(4-fluorobenzoyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11R,12S,16R)-14-(2,4-dichlorophenyl)-11-(4-fluorobenzoyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 27858747 |
| Molecular Formula | C26H16Cl2FN3O3 |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | (1S,11R,12S,16R)-14-(2,4-dichlorophenyl)-11-(4-fluorobenzoyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(F)cc1)[C@H]1[C@H]2C(=O)N(c3ccc(Cl)cc3Cl)C(=O)[C@H]2[C@H]2c3ccccc3C=NN21 |
| InChI | InChI=1S/C26H16Cl2FN3O3/c27-15-7-10-19(18(28)11-15)31-25(34)20-21(26(31)35)23(24(33)13-5-8-16(29)9-6-13)32-22(20)17-4-2-1-3-14(17)12-30-32/h1-12,20-23H/t20-,21+,22-,23-/m1/s1 |
| InChIKey | XPWOMIFNBDIXNV-KAOXLYBCSA-N |
| XLogP | 4.89 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|