C30H20ClN3O3 — CID 51555918
(1S,11S,12R,16S)-11-(4-chlorobenzoyl)-14-naphthalen-1-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 51555918) has the molecular formula C30H20ClN3O3 and a molecular weight of 505.96 g/mol. Its IUPAC name is (1S,11S,12R,16S)-11-(4-chlorobenzoyl)-14-naphthalen-1-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-11-(4-chlorobenzoyl)-14-naphthalen-1-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 51555918 |
| Molecular Formula | C30H20ClN3O3 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | (1S,11S,12R,16S)-11-(4-chlorobenzoyl)-14-naphthalen-1-yl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1ccc(Cl)cc1)[C@@H]1[C@@H]2C(=O)N(c3cccc4ccccc34)C(=O)[C@@H]2[C@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C30H20ClN3O3/c31-20-14-12-18(13-15-20)28(35)27-25-24(26-22-10-4-2-7-19(22)16-32-34(26)27)29(36)33(30(25)37)23-11-5-8-17-6-1-3-9-21(17)23/h1-16,24-27H/t24-,25+,26+,27-/m0/s1 |
| InChIKey | ZNANFPLECXFFTR-YAOOYPAMSA-N |
| XLogP | 5.25 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|