C30H27N3O4 — CID 124822134
(1S,11R,12R,16S)-11-benzoyl-14-(4-butoxyphenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 124822134) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is (1S,11R,12R,16S)-11-benzoyl-14-(4-butoxyphenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11R,12R,16S)-11-benzoyl-14-(4-butoxyphenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 124822134 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (1S,11R,12R,16S)-11-benzoyl-14-(4-butoxyphenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | CCCCOc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2c4ccccc4C=NN2[C@H]3C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27N3O4/c1-2-3-17-37-22-15-13-21(14-16-22)32-29(35)24-25(30(32)36)27(28(34)19-9-5-4-6-10-19)33-26(24)23-12-8-7-11-20(23)18-31-33/h4-16,18,24-27H,2-3,17H2,1H3/t24-,25+,26+,27+/m0/s1 |
| InChIKey | OKDFPUBXLBCVDC-FICKONGGSA-N |
| XLogP | 4.63 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|