C26H20N4O3 — CID 27809273
(1S,11R,12S,16R)-13,15-dioxo-N,14-diphenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 27809273) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is (1S,11R,12S,16R)-13,15-dioxo-N,14-diphenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | (1S,11R,12S,16R)-13,15-dioxo-N,14-diphenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 27809273 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (1S,11R,12S,16R)-13,15-dioxo-N,14-diphenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H]2c3ccccc3C=NN21 |
| InChI | InChI=1S/C26H20N4O3/c31-24(28-17-10-3-1-4-11-17)23-21-20(22-19-14-8-7-9-16(19)15-27-30(22)23)25(32)29(26(21)33)18-12-5-2-6-13-18/h1-15,20-23H,(H,28,31)/t20-,21+,22-,23-/m1/s1 |
| InChIKey | LOKZOBQZSBEFGP-KAOXLYBCSA-N |
| XLogP | 3.20 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|