C30H22N4O3 — CID 3922790
14-naphthalen-1-yl-13,15-dioxo-N-phenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide (PubChem CID 3922790) has the molecular formula C30H22N4O3 and a molecular weight of 486.53 g/mol. Its IUPAC name is 14-naphthalen-1-yl-13,15-dioxo-N-phenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide.
| Compound Name | 14-naphthalen-1-yl-13,15-dioxo-N-phenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 3922790 |
| Molecular Formula | C30H22N4O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 14-naphthalen-1-yl-13,15-dioxo-N-phenyl-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1C2C(=O)N(c3cccc4ccccc34)C(=O)C2C2c3ccccc3C=NN12 |
| InChI | InChI=1S/C30H22N4O3/c35-28(32-20-12-2-1-3-13-20)27-25-24(26-22-15-7-5-10-19(22)17-31-34(26)27)29(36)33(30(25)37)23-16-8-11-18-9-4-6-14-21(18)23/h1-17,24-27H,(H,32,35) |
| InChIKey | JAFDGZSPSJQGBP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|