C37H26Cl2N2O — CID 139236884
(3'E,4R,5R)-4-(4-chlorophenyl)-3'-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one (PubChem CID 139236884) has the molecular formula C37H26Cl2N2O and a molecular weight of 585.53 g/mol. Its IUPAC name is (3'E,4R,5R)-4-(4-chlorophenyl)-3'-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one.
| Compound Name | (3'E,4R,5R)-4-(4-chlorophenyl)-3'-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one |
|---|---|
| PubChem CID | 139236884 |
| Molecular Formula | C37H26Cl2N2O |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | (3'E,4R,5R)-4-(4-chlorophenyl)-3'-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one |
| SMILES | Cc1ccc(C2=NN(c3ccccc3)[C@]3(C(=O)/C(=C/c4ccc(Cl)cc4)c4ccccc43)[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C37H26Cl2N2O/c1-24-11-15-27(16-12-24)35-34(26-17-21-29(39)22-18-26)37(41(40-35)30-7-3-2-4-8-30)33-10-6-5-9-31(33)32(36(37)42)23-25-13-19-28(38)20-14-25/h2-23,34H,1H3/b32-23+/t34-,37-/m0/s1 |
| InChIKey | WAZYYXKACGAFNI-OPAFTHMLSA-N |
| XLogP | 9.33 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|