C39H32N2O4 — CID 139236882
(3'E,4R,5R)-3,4-bis(4-methoxyphenyl)-3'-[(4-methoxyphenyl)methylidene]-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one (PubChem CID 139236882) has the molecular formula C39H32N2O4 and a molecular weight of 592.70 g/mol. Its IUPAC name is (3'E,4R,5R)-3,4-bis(4-methoxyphenyl)-3'-[(4-methoxyphenyl)methylidene]-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one.
| Compound Name | (3'E,4R,5R)-3,4-bis(4-methoxyphenyl)-3'-[(4-methoxyphenyl)methylidene]-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one |
|---|---|
| PubChem CID | 139236882 |
| Molecular Formula | C39H32N2O4 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | (3'E,4R,5R)-3,4-bis(4-methoxyphenyl)-3'-[(4-methoxyphenyl)methylidene]-1-phenylspiro[4H-pyrazole-5,1'-indene]-2'-one |
| SMILES | COc1ccc(/C=C2/C(=O)[C@]3(c4ccccc42)[C@@H](c2ccc(OC)cc2)C(c2ccc(OC)cc2)=NN3c2ccccc2)cc1 |
| InChI | InChI=1S/C39H32N2O4/c1-43-30-19-13-26(14-20-30)25-34-33-11-7-8-12-35(33)39(38(34)42)36(27-15-21-31(44-2)22-16-27)37(28-17-23-32(45-3)24-18-28)40-41(39)29-9-5-4-6-10-29/h4-25,36H,1-3H3/b34-25+/t36-,39-/m0/s1 |
| InChIKey | LDOVLNHVNXQIJZ-CQOPAMSSSA-N |
| XLogP | 7.74 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|