C48H42N4O — CID 102376411
(1S,11S)-1,11-bis(4-methylphenyl)-2,4,8,10-tetraphenyl-3,4,8,9-tetrazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one (PubChem CID 102376411) has the molecular formula C48H42N4O and a molecular weight of 690.89 g/mol. Its IUPAC name is (1S,11S)-1,11-bis(4-methylphenyl)-2,4,8,10-tetraphenyl-3,4,8,9-tetrazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one.
| Compound Name | (1S,11S)-1,11-bis(4-methylphenyl)-2,4,8,10-tetraphenyl-3,4,8,9-tetrazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
|---|---|
| PubChem CID | 102376411 |
| Molecular Formula | C48H42N4O |
| Molecular Weight | 690.89 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | (1S,11S)-1,11-bis(4-methylphenyl)-2,4,8,10-tetraphenyl-3,4,8,9-tetrazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
| SMILES | Cc1ccc([C@@H]2C(c3ccccc3)=NN(c3ccccc3)C23CCCC2(C3=O)[C@H](c3ccc(C)cc3)C(c3ccccc3)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C48H42N4O/c1-34-24-28-36(29-25-34)42-44(38-16-7-3-8-17-38)49-51(40-20-11-5-12-21-40)47(42)32-15-33-48(46(47)53)43(37-30-26-35(2)27-31-37)45(39-18-9-4-10-19-39)50-52(48)41-22-13-6-14-23-41/h3-14,16-31,42-43H,15,32-33H2,1-2H3/t42-,43-,47?,48?/m1/s1 |
| InChIKey | RJKNKNRMCWSMLZ-AHSBQWKSSA-N |
| XLogP | 10.25 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.89 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |