C16H21BrN2O2 — CID 165368268
7-(2-bromophenyl)-6,6-dimethyl-8-nitro-2,3,5,7,8,8a-hexahydro-1H-indolizine (PubChem CID 165368268) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 7-(2-bromophenyl)-6,6-dimethyl-8-nitro-2,3,5,7,8,8a-hexahydro-1H-indolizine.
| Compound Name | 7-(2-bromophenyl)-6,6-dimethyl-8-nitro-2,3,5,7,8,8a-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 165368268 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 7-(2-bromophenyl)-6,6-dimethyl-8-nitro-2,3,5,7,8,8a-hexahydro-1H-indolizine |
| SMILES | CC1(C)CN2CCCC2C([N+](=O)[O-])C1c1ccccc1Br |
| InChI | InChI=1S/C16H21BrN2O2/c1-16(2)10-18-9-5-8-13(18)15(19(20)21)14(16)11-6-3-4-7-12(11)17/h3-4,6-7,13-15H,5,8-10H2,1-2H3 |
| InChIKey | HTJFNDIILRQNSN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|