C12H17BrN2O2S — CID 97055840
(2R)-2-(2-bromophenyl)-N,N-dimethylpyrrolidine-1-sulfonamide (PubChem CID 97055840) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is (2R)-2-(2-bromophenyl)-N,N-dimethylpyrrolidine-1-sulfonamide.
| Compound Name | (2R)-2-(2-bromophenyl)-N,N-dimethylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 97055840 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (2R)-2-(2-bromophenyl)-N,N-dimethylpyrrolidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C12H17BrN2O2S/c1-14(2)18(16,17)15-9-5-8-12(15)10-6-3-4-7-11(10)13/h3-4,6-7,12H,5,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | GUDPKHRLERHDPW-GFCCVEGCSA-N |
| XLogP | 2.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |