C16H22N4O3S — CID 75474761
N,N-dimethyl-2-(5-phenyl-1,2,4-oxadiazol-3-yl)azepane-1-sulfonamide (PubChem CID 75474761) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-phenyl-1,2,4-oxadiazol-3-yl)azepane-1-sulfonamide.
| Compound Name | N,N-dimethyl-2-(5-phenyl-1,2,4-oxadiazol-3-yl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 75474761 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N,N-dimethyl-2-(5-phenyl-1,2,4-oxadiazol-3-yl)azepane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCCCC1c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N4O3S/c1-19(2)24(21,22)20-12-8-4-7-11-14(20)15-17-16(23-18-15)13-9-5-3-6-10-13/h3,5-6,9-10,14H,4,7-8,11-12H2,1-2H3 |
| InChIKey | DODLOPLQTIVJJG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |