C17H22N4O4S — CID 97344792
(2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)-4-piperidin-1-ylsulfonylmorpholine (PubChem CID 97344792) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is (2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)-4-piperidin-1-ylsulfonylmorpholine.
| Compound Name | (2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)-4-piperidin-1-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 97344792 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)-4-piperidin-1-ylsulfonylmorpholine |
| SMILES | O=S(=O)(N1CCCCC1)N1CCO[C@H](c2noc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C17H22N4O4S/c22-26(23,20-9-5-2-6-10-20)21-11-12-24-15(13-21)16-18-17(25-19-16)14-7-3-1-4-8-14/h1,3-4,7-8,15H,2,5-6,9-13H2/t15-/m0/s1 |
| InChIKey | VSISKOMVDYNEDR-HNNXBMFYSA-N |
| XLogP | 1.84 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |