C16H18N4O2 — CID 97344593
4-[(2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)morpholin-4-yl]butanenitrile (PubChem CID 97344593) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-[(2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)morpholin-4-yl]butanenitrile.
| Compound Name | 4-[(2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)morpholin-4-yl]butanenitrile |
|---|---|
| PubChem CID | 97344593 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-[(2S)-2-(5-phenyl-1,2,4-oxadiazol-3-yl)morpholin-4-yl]butanenitrile |
| SMILES | N#CCCCN1CCO[C@H](c2noc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C16H18N4O2/c17-8-4-5-9-20-10-11-21-14(12-20)15-18-16(22-19-15)13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,9-12H2/t14-/m0/s1 |
| InChIKey | CIODOBFZHKMFTI-AWEZNQCLSA-N |
| XLogP | 2.41 |
| TPSA | 75.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|