C15H19ClN2O — CID 95341250
5-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]pentanenitrile (PubChem CID 95341250) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 5-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]pentanenitrile.
| Compound Name | 5-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]pentanenitrile |
|---|---|
| PubChem CID | 95341250 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-[(2R)-2-(2-chlorophenyl)morpholin-4-yl]pentanenitrile |
| SMILES | N#CCCCCN1CCO[C@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H19ClN2O/c16-14-7-3-2-6-13(14)15-12-18(10-11-19-15)9-5-1-4-8-17/h2-3,6-7,15H,1,4-5,9-12H2/t15-/m0/s1 |
| InChIKey | KWWZDDYHSUPDHV-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|