C15H20ClNO3 — CID 136589243
2-(2-chlorophenyl)-4-[[(2S)-1,4-dioxan-2-yl]methyl]morpholine (PubChem CID 136589243) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-[[(2S)-1,4-dioxan-2-yl]methyl]morpholine.
| Compound Name | 2-(2-chlorophenyl)-4-[[(2S)-1,4-dioxan-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 136589243 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(2-chlorophenyl)-4-[[(2S)-1,4-dioxan-2-yl]methyl]morpholine |
| SMILES | Clc1ccccc1C1CN(C[C@H]2COCCO2)CCO1 |
| InChI | InChI=1S/C15H20ClNO3/c16-14-4-2-1-3-13(14)15-10-17(5-6-20-15)9-12-11-18-7-8-19-12/h1-4,12,15H,5-11H2/t12-,15?/m0/s1 |
| InChIKey | QEBBKMQEHXPCFR-SFVWDYPZSA-N |
| XLogP | 2.13 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |