C13H17NO2 — CID 166602231
2-(1,4-dioxan-2-ylmethyl)-1,3-dihydroisoindole (PubChem CID 166602231) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethyl)-1,3-dihydroisoindole.
| Compound Name | 2-(1,4-dioxan-2-ylmethyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 166602231 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethyl)-1,3-dihydroisoindole |
| SMILES | c1ccc2c(c1)CN(CC1COCCO1)C2 |
| InChI | InChI=1S/C13H17NO2/c1-2-4-12-8-14(7-11(12)3-1)9-13-10-15-5-6-16-13/h1-4,13H,5-10H2 |
| InChIKey | CHXUMSQYHODJFY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |