C18H23N3O3 — CID 167764808
[4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 167764808) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is [4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 167764808 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | [4-(1,4-dioxan-2-ylmethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(CC2COCCO2)CC1 |
| InChI | InChI=1S/C18H23N3O3/c22-18(17-11-14-3-1-2-4-16(14)19-17)21-7-5-20(6-8-21)12-15-13-23-9-10-24-15/h1-4,11,15,19H,5-10,12-13H2 |
| InChIKey | DCQDJULNTXKCRF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |