C21H29N3O — CID 22660610
[4-(2-cyclohexylethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 22660610) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is [4-(2-cyclohexylethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [4-(2-cyclohexylethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 22660610 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | [4-(2-cyclohexylethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H29N3O/c25-21(20-16-18-8-4-5-9-19(18)22-20)24-14-12-23(13-15-24)11-10-17-6-2-1-3-7-17/h4-5,8-9,16-17,22H,1-3,6-7,10-15H2 |
| InChIKey | ZTAFKZVQNBOCBV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |