C17H23N3O3 — CID 167764803
[4-(2,2-dimethoxyethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 167764803) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is [4-(2,2-dimethoxyethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [4-(2,2-dimethoxyethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 167764803 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [4-(2,2-dimethoxyethyl)piperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | COC(CN1CCN(C(=O)c2cc3ccccc3[nH]2)CC1)OC |
| InChI | InChI=1S/C17H23N3O3/c1-22-16(23-2)12-19-7-9-20(10-8-19)17(21)15-11-13-5-3-4-6-14(13)18-15/h3-6,11,16,18H,7-10,12H2,1-2H3 |
| InChIKey | SRECUVMXNQYMPH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|