C14H16ClN3OS — CID 120899965
5-[[2-(2-chlorophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 120899965) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 5-[[2-(2-chlorophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[[2-(2-chlorophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120899965 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-[[2-(2-chlorophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCOC(c3ccccc3Cl)C2)s1 |
| InChI | InChI=1S/C14H16ClN3OS/c15-12-4-2-1-3-11(12)13-9-18(5-6-19-13)8-10-7-17-14(16)20-10/h1-4,7,13H,5-6,8-9H2,(H2,16,17) |
| InChIKey | XAIWHLBTUVVTSG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |