C10H17N3OS — CID 79771446
5-[(2-ethylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 79771446) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 5-[(2-ethylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-ethylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79771446 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 5-[(2-ethylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCC1CN(Cc2cnc(N)s2)CCO1 |
| InChI | InChI=1S/C10H17N3OS/c1-2-8-6-13(3-4-14-8)7-9-5-12-10(11)15-9/h5,8H,2-4,6-7H2,1H3,(H2,11,12) |
| InChIKey | QAWAWPSCRNOFEU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |