C9H16N4O2S — CID 81213350
[4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]morpholin-2-yl]methanol (PubChem CID 81213350) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is [4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]morpholin-2-yl]methanol.
| Compound Name | [4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81213350 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | [4-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]morpholin-2-yl]methanol |
| SMILES | NNc1ncc(CN2CCOC(CO)C2)s1 |
| InChI | InChI=1S/C9H16N4O2S/c10-12-9-11-3-8(16-9)5-13-1-2-15-7(4-13)6-14/h3,7,14H,1-2,4-6,10H2,(H,11,12) |
| InChIKey | WRAZNWAFOJMNBS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|