C17H24N4O2S — CID 146664786
1-[[5-[[(2R)-2-[(2-methyl-4-pyridinyl)methyl]morpholin-4-yl]methyl]-1,3-thiazol-2-yl]amino]ethanol (PubChem CID 146664786) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[[5-[[(2R)-2-[(2-methyl-4-pyridinyl)methyl]morpholin-4-yl]methyl]-1,3-thiazol-2-yl]amino]ethanol.
| Compound Name | 1-[[5-[[(2R)-2-[(2-methyl-4-pyridinyl)methyl]morpholin-4-yl]methyl]-1,3-thiazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 146664786 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[[5-[[(2R)-2-[(2-methyl-4-pyridinyl)methyl]morpholin-4-yl]methyl]-1,3-thiazol-2-yl]amino]ethanol |
| SMILES | Cc1cc(C[C@@H]2CN(Cc3cnc(NC(C)O)s3)CCO2)ccn1 |
| InChI | InChI=1S/C17H24N4O2S/c1-12-7-14(3-4-18-12)8-15-10-21(5-6-23-15)11-16-9-19-17(24-16)20-13(2)22/h3-4,7,9,13,15,22H,5-6,8,10-11H2,1-2H3,(H,19,20)/t13?,15-/m1/s1 |
| InChIKey | FIGSUVKYXFUWGV-AWKYBWMHSA-N |
| XLogP | 2.04 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|