C9H14N2O2S — CID 79833284
[4-(1,3-thiazol-4-ylmethyl)morpholin-2-yl]methanol (PubChem CID 79833284) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is [4-(1,3-thiazol-4-ylmethyl)morpholin-2-yl]methanol.
| Compound Name | [4-(1,3-thiazol-4-ylmethyl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 79833284 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | [4-(1,3-thiazol-4-ylmethyl)morpholin-2-yl]methanol |
| SMILES | OCC1CN(Cc2cscn2)CCO1 |
| InChI | InChI=1S/C9H14N2O2S/c12-5-9-4-11(1-2-13-9)3-8-6-14-7-10-8/h6-7,9,12H,1-5H2 |
| InChIKey | WTKQKGNKHTYXSE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |