C14H14ClFN2OS — CID 124619828
(2R)-2-(2-chloro-4-fluorophenyl)-4-(1,3-thiazol-4-ylmethyl)morpholine (PubChem CID 124619828) has the molecular formula C14H14ClFN2OS and a molecular weight of 312.80 g/mol. Its IUPAC name is (2R)-2-(2-chloro-4-fluorophenyl)-4-(1,3-thiazol-4-ylmethyl)morpholine.
| Compound Name | (2R)-2-(2-chloro-4-fluorophenyl)-4-(1,3-thiazol-4-ylmethyl)morpholine |
|---|---|
| PubChem CID | 124619828 |
| Molecular Formula | C14H14ClFN2OS |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (2R)-2-(2-chloro-4-fluorophenyl)-4-(1,3-thiazol-4-ylmethyl)morpholine |
| SMILES | Fc1ccc([C@@H]2CN(Cc3cscn3)CCO2)c(Cl)c1 |
| InChI | InChI=1S/C14H14ClFN2OS/c15-13-5-10(16)1-2-12(13)14-7-18(3-4-19-14)6-11-8-20-9-17-11/h1-2,5,8-9,14H,3-4,6-7H2/t14-/m0/s1 |
| InChIKey | QPXZUBAXNZYBAN-AWEZNQCLSA-N |
| XLogP | 3.51 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |