C14H19ClFNO3S — CID 124619802
(2R)-2-(2-chloro-4-fluorophenyl)-4-(2-ethylsulfonylethyl)morpholine (PubChem CID 124619802) has the molecular formula C14H19ClFNO3S and a molecular weight of 335.83 g/mol. Its IUPAC name is (2R)-2-(2-chloro-4-fluorophenyl)-4-(2-ethylsulfonylethyl)morpholine.
| Compound Name | (2R)-2-(2-chloro-4-fluorophenyl)-4-(2-ethylsulfonylethyl)morpholine |
|---|---|
| PubChem CID | 124619802 |
| Molecular Formula | C14H19ClFNO3S |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2R)-2-(2-chloro-4-fluorophenyl)-4-(2-ethylsulfonylethyl)morpholine |
| SMILES | CCS(=O)(=O)CCN1CCO[C@H](c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H19ClFNO3S/c1-2-21(18,19)8-6-17-5-7-20-14(10-17)12-4-3-11(16)9-13(12)15/h3-4,9,14H,2,5-8,10H2,1H3/t14-/m0/s1 |
| InChIKey | DXKLODDQWXWDIJ-AWEZNQCLSA-N |
| XLogP | 2.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |