C16H15ClFNO4 — CID 154746798
5-[[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]furan-3-carboxylic acid (PubChem CID 154746798) has the molecular formula C16H15ClFNO4 and a molecular weight of 339.75 g/mol. Its IUPAC name is 5-[[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 154746798 |
| Molecular Formula | C16H15ClFNO4 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 5-[[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CN2CCOC(c3ccc(F)cc3Cl)C2)c1 |
| InChI | InChI=1S/C16H15ClFNO4/c17-14-6-11(18)1-2-13(14)15-8-19(3-4-22-15)7-12-5-10(9-23-12)16(20)21/h1-2,5-6,9,15H,3-4,7-8H2,(H,20,21) |
| InChIKey | GUNYXPNTTIBDMO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |