C15H16ClFN4O — CID 124619849
2-[[(2S)-2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]pyrimidin-4-amine (PubChem CID 124619849) has the molecular formula C15H16ClFN4O and a molecular weight of 322.77 g/mol. Its IUPAC name is 2-[[(2S)-2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]pyrimidin-4-amine.
| Compound Name | 2-[[(2S)-2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 124619849 |
| Molecular Formula | C15H16ClFN4O |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-[[(2S)-2-(2-chloro-4-fluorophenyl)morpholin-4-yl]methyl]pyrimidin-4-amine |
| SMILES | Nc1ccnc(CN2CCO[C@@H](c3ccc(F)cc3Cl)C2)n1 |
| InChI | InChI=1S/C15H16ClFN4O/c16-12-7-10(17)1-2-11(12)13-8-21(5-6-22-13)9-15-19-4-3-14(18)20-15/h1-4,7,13H,5-6,8-9H2,(H2,18,19,20)/t13-/m1/s1 |
| InChIKey | JSVVGTGEPKGHKM-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |