C16H17FN2O — CID 110270812
4-[(3-fluorophenyl)methyl]-2-pyridin-2-ylmorpholine (PubChem CID 110270812) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-2-pyridin-2-ylmorpholine.
| Compound Name | 4-[(3-fluorophenyl)methyl]-2-pyridin-2-ylmorpholine |
|---|---|
| PubChem CID | 110270812 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-2-pyridin-2-ylmorpholine |
| SMILES | Fc1cccc(CN2CCOC(c3ccccn3)C2)c1 |
| InChI | InChI=1S/C16H17FN2O/c17-14-5-3-4-13(10-14)11-19-8-9-20-16(12-19)15-6-1-2-7-18-15/h1-7,10,16H,8-9,11-12H2 |
| InChIKey | SDCREIPUNDIARS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |