C16H17FN2O — CID 175587211
4-benzyl-5,5-dideuterio-2-(5-fluoro-2-pyridinyl)morpholine (PubChem CID 175587211) has the molecular formula C16H17FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-benzyl-5,5-dideuterio-2-(5-fluoro-2-pyridinyl)morpholine.
| Compound Name | 4-benzyl-5,5-dideuterio-2-(5-fluoro-2-pyridinyl)morpholine |
|---|---|
| PubChem CID | 175587211 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-benzyl-5,5-dideuterio-2-(5-fluoro-2-pyridinyl)morpholine |
| SMILES | [2H]C1([2H])COC(c2ccc(F)cn2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C16H17FN2O/c17-14-6-7-15(18-10-14)16-12-19(8-9-20-16)11-13-4-2-1-3-5-13/h1-7,10,16H,8-9,11-12H2/i8D2 |
| InChIKey | PDLKLYSEMKDIPP-MGVXTIMCSA-N |
| XLogP | 2.79 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |