C22H23F2N3O2 — CID 127250719
2-[5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-[(4-fluorophenyl)methyl]morpholine (PubChem CID 127250719) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-[(4-fluorophenyl)methyl]morpholine.
| Compound Name | 2-[5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-[(4-fluorophenyl)methyl]morpholine |
|---|---|
| PubChem CID | 127250719 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[5-[2-(2-fluorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-[(4-fluorophenyl)methyl]morpholine |
| SMILES | Fc1ccc(CN2CCOC(c3cc(CCOc4ccccc4F)[nH]n3)C2)cc1 |
| InChI | InChI=1S/C22H23F2N3O2/c23-17-7-5-16(6-8-17)14-27-10-12-29-22(15-27)20-13-18(25-26-20)9-11-28-21-4-2-1-3-19(21)24/h1-8,13,22H,9-12,14-15H2,(H,25,26) |
| InChIKey | KQAXGXQIWGSNRH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |