C25H25ClN4O2 — CID 124964103
(2S)-2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-(quinolin-4-ylmethyl)morpholine (PubChem CID 124964103) has the molecular formula C25H25ClN4O2 and a molecular weight of 448.95 g/mol. Its IUPAC name is (2S)-2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-(quinolin-4-ylmethyl)morpholine.
| Compound Name | (2S)-2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-(quinolin-4-ylmethyl)morpholine |
|---|---|
| PubChem CID | 124964103 |
| Molecular Formula | C25H25ClN4O2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (2S)-2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]-4-(quinolin-4-ylmethyl)morpholine |
| SMILES | Clc1ccc(OCCc2cc([C@@H]3CN(Cc4ccnc5ccccc45)CCO3)n[nH]2)cc1 |
| InChI | InChI=1S/C25H25ClN4O2/c26-19-5-7-21(8-6-19)31-13-10-20-15-24(29-28-20)25-17-30(12-14-32-25)16-18-9-11-27-23-4-2-1-3-22(18)23/h1-9,11,15,25H,10,12-14,16-17H2,(H,28,29)/t25-/m0/s1 |
| InChIKey | HVELKJUZCVLQGN-VWLOTQADSA-N |
| XLogP | 4.81 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |