C25H26N4O2 — CID 132771953
2-[5-(2-phenoxyethyl)-1H-pyrazol-3-yl]-4-(quinolin-6-ylmethyl)morpholine (PubChem CID 132771953) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[5-(2-phenoxyethyl)-1H-pyrazol-3-yl]-4-(quinolin-6-ylmethyl)morpholine.
| Compound Name | 2-[5-(2-phenoxyethyl)-1H-pyrazol-3-yl]-4-(quinolin-6-ylmethyl)morpholine |
|---|---|
| PubChem CID | 132771953 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-[5-(2-phenoxyethyl)-1H-pyrazol-3-yl]-4-(quinolin-6-ylmethyl)morpholine |
| SMILES | c1ccc(OCCc2cc(C3CN(Cc4ccc5ncccc5c4)CCO3)n[nH]2)cc1 |
| InChI | InChI=1S/C25H26N4O2/c1-2-6-22(7-3-1)30-13-10-21-16-24(28-27-21)25-18-29(12-14-31-25)17-19-8-9-23-20(15-19)5-4-11-26-23/h1-9,11,15-16,25H,10,12-14,17-18H2,(H,27,28) |
| InChIKey | PDUDREDMCHMTPC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |