C20H22N4O — CID 110115969
2-(2,6-dimethylpyrimidin-4-yl)-4-(quinolin-6-ylmethyl)morpholine (PubChem CID 110115969) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(2,6-dimethylpyrimidin-4-yl)-4-(quinolin-6-ylmethyl)morpholine.
| Compound Name | 2-(2,6-dimethylpyrimidin-4-yl)-4-(quinolin-6-ylmethyl)morpholine |
|---|---|
| PubChem CID | 110115969 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-(2,6-dimethylpyrimidin-4-yl)-4-(quinolin-6-ylmethyl)morpholine |
| SMILES | Cc1cc(C2CN(Cc3ccc4ncccc4c3)CCO2)nc(C)n1 |
| InChI | InChI=1S/C20H22N4O/c1-14-10-19(23-15(2)22-14)20-13-24(8-9-25-20)12-16-5-6-18-17(11-16)4-3-7-21-18/h3-7,10-11,20H,8-9,12-13H2,1-2H3 |
| InChIKey | RSYZFSIRXBPCEP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |