C21H21ClN4O3 — CID 127252255
[2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone (PubChem CID 127252255) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is [2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone.
| Compound Name | [2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 127252255 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-[5-[2-(4-chlorophenoxy)ethyl]-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCOC(c2cc(CCOc3ccc(Cl)cc3)[nH]n2)C1 |
| InChI | InChI=1S/C21H21ClN4O3/c22-16-3-5-18(6-4-16)28-10-7-17-12-19(25-24-17)20-14-26(9-11-29-20)21(27)15-2-1-8-23-13-15/h1-6,8,12-13,20H,7,9-11,14H2,(H,24,25) |
| InChIKey | VJYPYYXKMJYPEW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |