C15H18N4O3 — CID 110270747
[2-[5-(2-hydroxyethyl)-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone (PubChem CID 110270747) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is [2-[5-(2-hydroxyethyl)-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone.
| Compound Name | [2-[5-(2-hydroxyethyl)-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 110270747 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [2-[5-(2-hydroxyethyl)-1H-pyrazol-3-yl]morpholin-4-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCOC(c2cc(CCO)[nH]n2)C1 |
| InChI | InChI=1S/C15H18N4O3/c20-6-3-12-8-13(18-17-12)14-10-19(5-7-22-14)15(21)11-2-1-4-16-9-11/h1-2,4,8-9,14,20H,3,5-7,10H2,(H,17,18) |
| InChIKey | RDTNFHJFQAFWPD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |