C16H15BrN2O2 — CID 124571795
[(2R)-2-(2-bromophenyl)morpholin-4-yl]-pyridin-3-ylmethanone (PubChem CID 124571795) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is [(2R)-2-(2-bromophenyl)morpholin-4-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2R)-2-(2-bromophenyl)morpholin-4-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 124571795 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | [(2R)-2-(2-bromophenyl)morpholin-4-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCO[C@H](c2ccccc2Br)C1 |
| InChI | InChI=1S/C16H15BrN2O2/c17-14-6-2-1-5-13(14)15-11-19(8-9-21-15)16(20)12-4-3-7-18-10-12/h1-7,10,15H,8-9,11H2/t15-/m0/s1 |
| InChIKey | YNSIFYDCGHXYBU-HNNXBMFYSA-N |
| XLogP | 3.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |