C17H18N2O — CID 95292486
[(3R)-3-(2-methylphenyl)pyrrolidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 95292486) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is [(3R)-3-(2-methylphenyl)pyrrolidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3R)-3-(2-methylphenyl)pyrrolidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 95292486 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [(3R)-3-(2-methylphenyl)pyrrolidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | Cc1ccccc1[C@H]1CCN(C(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C17H18N2O/c1-13-5-2-3-7-16(13)15-8-10-19(12-15)17(20)14-6-4-9-18-11-14/h2-7,9,11,15H,8,10,12H2,1H3/t15-/m0/s1 |
| InChIKey | DWYCDQNWOXXULO-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |