C24H25N3O — CID 119073506
[3-(5-amino-3-pyridinyl)phenyl]-[3-(2-methylphenyl)piperidin-1-yl]methanone (PubChem CID 119073506) has the molecular formula C24H25N3O and a molecular weight of 371.48 g/mol. Its IUPAC name is [3-(5-amino-3-pyridinyl)phenyl]-[3-(2-methylphenyl)piperidin-1-yl]methanone.
| Compound Name | [3-(5-amino-3-pyridinyl)phenyl]-[3-(2-methylphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119073506 |
| Molecular Formula | C24H25N3O |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | [3-(5-amino-3-pyridinyl)phenyl]-[3-(2-methylphenyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccccc1C1CCCN(C(=O)c2cccc(-c3cncc(N)c3)c2)C1 |
| InChI | InChI=1S/C24H25N3O/c1-17-6-2-3-10-23(17)20-9-5-11-27(16-20)24(28)19-8-4-7-18(12-19)21-13-22(25)15-26-14-21/h2-4,6-8,10,12-15,20H,5,9,11,16,25H2,1H3 |
| InChIKey | PTMQEGFQNQJXAR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |