C21H21N3O3 — CID 70723396
6-[3-(2-methylphenyl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 70723396) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 6-[3-(2-methylphenyl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[3-(2-methylphenyl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 70723396 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-[3-(2-methylphenyl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1ccccc1C1CCCN(C(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)C1 |
| InChI | InChI=1S/C21H21N3O3/c1-13-5-2-3-7-16(13)15-6-4-10-24(12-15)21(27)14-8-9-17-18(11-14)23-20(26)19(25)22-17/h2-3,5,7-9,11,15H,4,6,10,12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | ITHADBHEFZACMS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|