C15H17N3O4 — CID 23474515
6-(2,6-dimethylmorpholine-4-carbonyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 23474515) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 6-(2,6-dimethylmorpholine-4-carbonyl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(2,6-dimethylmorpholine-4-carbonyl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 23474515 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 6-(2,6-dimethylmorpholine-4-carbonyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CC1CN(C(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)CC(C)O1 |
| InChI | InChI=1S/C15H17N3O4/c1-8-6-18(7-9(2)22-8)15(21)10-3-4-11-12(5-10)17-14(20)13(19)16-11/h3-5,8-9H,6-7H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | PVJTVPKQKQTETF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|