C16H16N6O3 — CID 99947738
6-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 99947738) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 6-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 99947738 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 6-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=C(c1ccc2[nH]c(=O)c(=O)[nH]c2c1)N1CCC[C@@H](c2ncn[nH]2)C1 |
| InChI | InChI=1S/C16H16N6O3/c23-14-15(24)20-12-6-9(3-4-11(12)19-14)16(25)22-5-1-2-10(7-22)13-17-8-18-21-13/h3-4,6,8,10H,1-2,5,7H2,(H,19,23)(H,20,24)(H,17,18,21)/t10-/m1/s1 |
| InChIKey | BPLXUDGNKRRWDK-SNVBAGLBSA-N |
| XLogP | 0.35 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|