C19H25N3O3 — CID 154847156
6-[3-(3,3-dimethylbutyl)pyrrolidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 154847156) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-[3-(3,3-dimethylbutyl)pyrrolidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[3-(3,3-dimethylbutyl)pyrrolidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 154847156 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 6-[3-(3,3-dimethylbutyl)pyrrolidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CC(C)(C)CCC1CCN(C(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-19(2,3)8-6-12-7-9-22(11-12)18(25)13-4-5-14-15(10-13)21-17(24)16(23)20-14/h4-5,10,12H,6-9,11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | UPEIIMLZXGAODW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|