C16H19N3O5 — CID 70771275
6-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 70771275) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 6-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 70771275 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 6-[(3R,4R)-4-ethyl-3,4-dihydroxypiperidine-1-carbonyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CC[C@@]1(O)CCN(C(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)C[C@H]1O |
| InChI | InChI=1S/C16H19N3O5/c1-2-16(24)5-6-19(8-12(16)20)15(23)9-3-4-10-11(7-9)18-14(22)13(21)17-10/h3-4,7,12,20,24H,2,5-6,8H2,1H3,(H,17,21)(H,18,22)/t12-,16-/m1/s1 |
| InChIKey | CQZBUNBOKDGCKN-MLGOLLRUSA-N |
| XLogP | -0.44 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|