C16H16F2N2O — CID 127245674
4-[(3,5-difluorophenyl)methyl]-2-pyridin-2-ylmorpholine (PubChem CID 127245674) has the molecular formula C16H16F2N2O and a molecular weight of 290.31 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methyl]-2-pyridin-2-ylmorpholine.
| Compound Name | 4-[(3,5-difluorophenyl)methyl]-2-pyridin-2-ylmorpholine |
|---|---|
| PubChem CID | 127245674 |
| Molecular Formula | C16H16F2N2O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methyl]-2-pyridin-2-ylmorpholine |
| SMILES | Fc1cc(F)cc(CN2CCOC(c3ccccn3)C2)c1 |
| InChI | InChI=1S/C16H16F2N2O/c17-13-7-12(8-14(18)9-13)10-20-5-6-21-16(11-20)15-3-1-2-4-19-15/h1-4,7-9,16H,5-6,10-11H2 |
| InChIKey | YCAVIOAORRKNRF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |