C13H13ClFN3OS — CID 124619492
(2S)-2-(2-chloro-4-fluorophenyl)-4-(thiadiazol-4-ylmethyl)morpholine (PubChem CID 124619492) has the molecular formula C13H13ClFN3OS and a molecular weight of 313.78 g/mol. Its IUPAC name is (2S)-2-(2-chloro-4-fluorophenyl)-4-(thiadiazol-4-ylmethyl)morpholine.
| Compound Name | (2S)-2-(2-chloro-4-fluorophenyl)-4-(thiadiazol-4-ylmethyl)morpholine |
|---|---|
| PubChem CID | 124619492 |
| Molecular Formula | C13H13ClFN3OS |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (2S)-2-(2-chloro-4-fluorophenyl)-4-(thiadiazol-4-ylmethyl)morpholine |
| SMILES | Fc1ccc([C@H]2CN(Cc3csnn3)CCO2)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClFN3OS/c14-12-5-9(15)1-2-11(12)13-7-18(3-4-19-13)6-10-8-20-17-16-10/h1-2,5,8,13H,3-4,6-7H2/t13-/m1/s1 |
| InChIKey | QDBXORXYALOMOV-CYBMUJFWSA-N |
| XLogP | 2.90 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |