C13H16N4OS — CID 125021683
6-[(2S)-4-(1,3-thiazol-2-ylmethyl)morpholin-2-yl]pyridin-2-amine (PubChem CID 125021683) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 6-[(2S)-4-(1,3-thiazol-2-ylmethyl)morpholin-2-yl]pyridin-2-amine.
| Compound Name | 6-[(2S)-4-(1,3-thiazol-2-ylmethyl)morpholin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 125021683 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 6-[(2S)-4-(1,3-thiazol-2-ylmethyl)morpholin-2-yl]pyridin-2-amine |
| SMILES | Nc1cccc([C@@H]2CN(Cc3nccs3)CCO2)n1 |
| InChI | InChI=1S/C13H16N4OS/c14-12-3-1-2-10(16-12)11-8-17(5-6-18-11)9-13-15-4-7-19-13/h1-4,7,11H,5-6,8-9H2,(H2,14,16)/t11-/m0/s1 |
| InChIKey | YLOJKMZVVLQYFS-NSHDSACASA-N |
| XLogP | 1.69 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |